On Target 5HT5A_HUMAN 0.23493975/CHEMBL161507
For the given ligand test1, we have found in our database that, being scored 0.23493975, the most similar ligand is CHEMBL161507. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL161507 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCCN[C@@H]1CCc2c(cccc2C(=O)OC)[C@@H]1C |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000000 01000a00 00100102 00010600 00001021 0000c402 00000000 20000001 00000980 00080ac0 28300000 40808800 00008002 00210000 00000020 0a0c0008 00020200 02000000 00002000 40000201 00400500 18220a60 01004000 81400014 00000000 80002201 00000000 10000000 04000203 0006000a c0000004 00002600 |