On Target HRH3_HUMAN 0.3272727/CHEMBL514217
For the given ligand test1, we have found in our database that, being scored 0.3272727, the most similar ligand is CHEMBL514217. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL514217 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CN(CCN1CCCCC1)C(=O)[C@@H]2CC[C@]3(CC2)OC(=O)c4ccccc34 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00010000 01002800 00100102 04010700 00080010 0800c000 00000000 20000008 00000900 000808c0 08300000 50019800 0400802a 01a12000 00000020 02081008 00820000 02000200 02402000 00000201 00400520 38020f70 01004001 0250001c 00000400 80002201 00080000 10000000 08000202 00060003 c0020000 02000600 |