On Target OPRK_HUMAN 0.8632479/CHEMBL2381586
For the given ligand test1, we have found in our database that, being scored 0.8632479, the most similar ligand is CHEMBL2381586. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL2381586 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | COC(=O)[C@@H]1C[C@H](OC(=O)CC(=O)OC(C)(C)C)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)c4cocc4 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00050040 81200000 00080102 00014300 802c0051 00200000 00004000 00200000 000a4900 010a0040 04180000 4008d000 54008428 00b10000 00000000 5a081008 08820020 82050100 13402000 00002001 00000020 18000a00 01000000 00080014 00000400 00004000 00080410 0a800010 60000202 00020002 40020000 02000000 |