On Target CXCR3_HUMAN 0.2746114/CHEMBL3956593
For the given ligand test1, we have found in our database that, being scored 0.2746114, the most similar ligand is CHEMBL3956593. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3956593 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCOC(=O)C1CCC(CN(Cc2ccc(OCCN3C(=O)CCC3=O)c(OC)c2)C(C)c4ccc5OCCc5c4)CC1 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 04033000 45005008 20100108 00210702 000810c1 02000010 12040000 22001240 00000000 000808c0 08200000 40019000 0480c80a 00800000 010c1401 0208b018 18822000 02000000 06482400 00020201 00020020 18048e10 13000000 00548018 00000400 c0000000 08b20000 90800005 00000302 0006000b 20060000 00800680 |