On Target GRM5_HUMAN 0.24539877/CHEMBL92162
For the given ligand test1, we have found in our database that, being scored 0.24539877, the most similar ligand is CHEMBL92162. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL92162 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | N[C@@](CC1c2ccccc2Sc3ccccc13)([C@@H]4C[C@@H](C4)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00010000 01800200 00020102 00110600 000e0000 00100020 00000000 01004002 00000800 000808c0 08100400 6001b000 0c008018 01a00010 00000000 00080008 04001000 02000004 00602010 00000001 80000100 18000a00 03800000 00400019 00003000 a0000000 00000000 40001000 00000282 0007000a 00020100 00410420 |