On Target CLTR1_HUMAN 0.25603864/CHEMBL3401686
For the given ligand test1, we have found in our database that, being scored 0.25603864, the most similar ligand is CHEMBL3401686. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3401686 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | OC(=O)CCCN1CC(Oc2c(OCc3ccc(OCCCCc4ccccc4)cc3)cccc12)C(=O)O |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 04026002 81000008 2010110a 00210702 a0181080 06006000 02040000 20000000 00060920 000808c0 08340004 5001d000 0c80c002 08210000 112a1041 0208e008 10840080 82000000 08c00010 00022601 41100100 18040a20 37400080 08c09010 00001001 80002000 28420008 10800081 00008200 0006000a 40000400 00822f80 |