On Target AGTR2_HUMAN 0.22167487/CHEMBL214592
For the given ligand test1, we have found in our database that, being scored 0.22167487, the most similar ligand is CHEMBL214592. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL214592 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCCCOC(=O)NS(=O)(=O)c1ccc(CCCC)cc1c2ccc(Cn3ccnc3)cc2 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00002012 01c01201 01000102 04b10700 00080049 00000020 00000000 80001000 00000908 000828c0 0810a009 60008000 80089808 00210101 88300080 001c000c 02022080 02001000 04400000 10006001 80000100 18048c00 31200040 89480018 0000a004 80000082 80080000 0000006f 04004600 2046004a 400c5000 00010660 |