On Target AA2AR_HUMAN 0.2631579/CHEMBL1950653
For the given ligand test1, we have found in our database that, being scored 0.2631579, the most similar ligand is CHEMBL1950653. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1950653 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCNC(=O)[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(N)nc(NCCc4ccc(CCC(=O)N[C@@H](Cc5ccccc5)C(=O)OC)cc4)nc23 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 0005000a 01c05a09 80180100 88090720 021800e8 0000c000 0000ac00 20100804 00400980 218808f0 0c30800c 4001f804 16009032 01880300 80081088 381fc00c 10220020 82004000 19c00008 80a01201 80080120 5c200e70 378048c0 8d50081c 50000c01 c0080002 00800200 10000071 04000209 0046180b e0285000 00002ec0 |