On Target DRD1_HUMAN 0.29239765/CHEMBL291143
For the given ligand test1, we have found in our database that, being scored 0.29239765, the most similar ligand is CHEMBL291143. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL291143 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | NC[C@@H]1O[C@@H](Cc2c(O)c(O)ccc12)C34CC5CC(CC(C5)C3)C4 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000000 4b000008 20010502 80010700 00080071 c0004002 02100000 00000241 00000900 00080848 08100000 40808940 00000002 00a10000 00041020 0208b008 08800000 02000000 06402002 00020201 00010520 18000020 03004000 81400010 10000400 80002201 005a0000 00000000 04000203 00064802 40020000 02000400 |