On Target DRD4_HUMAN 0.32738096/CHEMBL3318835
For the given ligand test1, we have found in our database that, being scored 0.32738096, the most similar ligand is CHEMBL3318835. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3318835 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | Fc1ccc(cc1)C(=O)CCCN2CCC(CC2)(OC(=O)CCCCCCC(=O)OC3(CCN(CCCC(=O)c4ccc(F)cc4)CC3)c5ccc(Cl)cc5)c6ccc(Cl)cc6 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00038040 01000a00 00100102 02010700 00080010 00004010 00000000 20000000 00100900 000808c0 08300000 50019800 060080ae 00a91000 00200000 020c1008 00a20000 02000080 00c02000 00100201 00000120 18020b20 01000080 00500014 00002401 80002000 000c0000 10000001 00000200 0006800e c0020000 02822600 |