On Target TSHR_HUMAN 0.20207255/CHEMBL3945037
For the given ligand test1, we have found in our database that, being scored 0.20207255, the most similar ligand is CHEMBL3945037. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3945037 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CC(=O)N1CCC(C)(c2ccccc2)c3cc(NC(=O)O[C@H]4CC5CC[C@H]4C5)ccc13 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 08004002 01401200 00100100 00010700 24084020 00082040 00000000 a1000000 00400a04 000808d0 08380024 40008000 00008002 00900900 00020040 001c0008 00868000 02800001 0a402808 00400201 44100100 18040e10 21002002 00400018 00040000 a1001002 00000010 50001080 00488280 8106000b 00020080 20000600 |