On Target NPFF1_HUMAN 0.18181819/CHEMBL1672379
For the given ligand test1, we have found in our database that, being scored 0.18181819, the most similar ligand is CHEMBL1672379. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1672379 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CC(C)C[C@H](NC(=O)[C@@H](N)CO)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00030000 01007000 00100100 04010e00 00000080 00000010 00000000 2000200c 00200a80 000a08c2 08300000 4003b000 16009012 00002001 80180000 00180008 10000000 02000000 00c00008 00000201 00000100 38250e20 030000c3 83500018 00000801 80000000 40000000 10000000 0c000010 00060003 a0084000 00802600 |