On Target 5HT1B_HUMAN 0.29411766/CHEMBL82488
For the given ligand test1, we have found in our database that, being scored 0.29411766, the most similar ligand is CHEMBL82488. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL82488 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | NC(=O)c1ccc2C(CCN3CCC(=CC3)c4coc5cc(F)ccc45)OCCc2c1 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000050 08208a00 00190500 42054600 00000251 00004112 80184080 60201641 00024900 00580ad8 0c300200 50008900 c0008d12 002b1080 10040002 1a0c0008 28200420 02090140 04800402 00800201 00010120 58028628 0100c080 00480034 08010401 80006201 08482010 5a810015 a0402201 01068c0a c4040000 02002600 |