On Target CNR2_HUMAN 0.36301368/CHEMBL1923778
For the given ligand test1, we have found in our database that, being scored 0.36301368, the most similar ligand is CHEMBL1923778. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1923778 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCCCCC(=O)OCC(O)CO)c1 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 04010041 43000008 2000050a 00010300 00081040 42000000 42000000 00000000 00000800 01080840 08100000 40009000 0480800a 20a00080 11000001 0008b008 00820000 02000000 01482000 00020a01 00000120 08000a00 05000000 08400010 00000400 80000000 00000000 00000020 00010202 0002000a 00020000 00000400 |