On Target CCKAR_HUMAN 0.21962617/CHEMBL168182
For the given ligand test1, we have found in our database that, being scored 0.21962617, the most similar ligand is CHEMBL168182. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL168182 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | C[C@@](N)(Cc1cn(C(=O)OC2C3CC4CC(CC2C4)C3)c5ccccc15)C(=O)N[C@H](CC(=O)O)Cc6ccccc6 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 08010002 01401a00 00100182 c1810710 000c5200 00000000 00002400 a0000004 00400880 000908d0 08300004 4001b002 1c008802 00e80900 00001040 081c000c 00a30000 82800001 03e03418 00000201 44000100 38308e18 21800081 8340001c 10043801 80000002 08000200 10000000 0c000200 0006000b 00160200 00402620 |