On Target OPRX_HUMAN 0.39800996/CHEMBL3581762
For the given ligand test1, we have found in our database that, being scored 0.39800996, the most similar ligand is CHEMBL3581762. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3581762 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CO[C@]12CC[C@@]3(C[C@]1(C)[C@H](O)c4cocc4)[C@H]5Cc6ccc(O)c7O[C@@H]2[C@]3(CCN5CC8CC8)c67 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 04001000 43200208 2018050a 00214700 00381061 c2000002 02005000 20200241 00026990 010818c0 0c380000 50818040 40804402 21b00080 11240021 520ca018 08800220 22058000 17482002 00020201 00000100 18200010 05004040 89580410 00000000 c0004001 00120610 1a800011 64000302 0007c80a 40020000 00002f40 |