On Target ACM2_HUMAN 0.38297874/CHEMBL74736
For the given ligand test1, we have found in our database that, being scored 0.38297874, the most similar ligand is CHEMBL74736. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL74736 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CCN(CC)CCOCCOC(=O)C1(CCCCC1)c2ccccc2 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00010000 01000000 0000050a 80010700 000800c0 00000000 00000000 00000040 00002800 00080840 08300000 40009000 0500800a 00a00000 40041008 00099008 18820000 02000000 06402000 00000001 00010120 08000a00 17000000 08400010 00000400 80000000 00000000 00000021 00000202 00060002 00022000 00000600 |