On Target HRH4_HUMAN 0.30120483/CHEMBL105803
For the given ligand test1, we have found in our database that, being scored 0.30120483, the most similar ligand is CHEMBL105803. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL105803 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | C(OCc1ccccc1)[C@H]2CC[C@@H](O2)c3c[nH]cn3 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000002 01001001 80000102 00810310 04080150 00004000 01002000 00000040 10402b00 000c0840 20008000 40008800 00000000 02910800 000a0000 020c900c 00808000 07000000 00412008 40400001 00100420 08000020 a5001000 08400114 00040400 8000a200 00080000 000000a0 04000206 00420400 c0000000 22000c00 |