On Target HRH1_HUMAN 0.2793296/CHEMBL328356
For the given ligand test1, we have found in our database that, being scored 0.2793296, the most similar ligand is CHEMBL328356. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL328356 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CN(C)CC1C[C@H]2[C@H](O1)c3ccccc3N(C)c4ccccc24 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000002 01000008 00100102 80010700 000800d0 00004000 01002010 00000040 00102900 004808c0 08301004 60019000 04000000 01210000 000e1048 02081008 0804c000 02000000 0c40200a 00000001 40010120 58100030 33000040 00500110 50000c00 80002000 02080008 10001080 00008202 00261402 40000080 22000700 |