On Target 5HT7R_HUMAN 0.36419752/CHEMBL487192
For the given ligand test1, we have found in our database that, being scored 0.36419752, the most similar ligand is CHEMBL487192. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL487192 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | OC(=O)[C@@H](OC(=O)\C=C\c1ccc(O)c(O)c1)[C@](O)(Cc2ccc(O)c(O)c2)C(=O)O |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00050000 43000008 20000502 00010300 002c0041 40200000 82000080 00000400 01800800 01080840 48100000 4010d080 1c008002 00200000 00040002 00089008 08020400 82000000 21418018 00020201 00000120 08000a00 05000041 08400014 00001c00 80000000 0052a000 40000420 00400202 0002010a 04000000 02400410 |