On Target CCR2_HUMAN 0.31034482/CHEMBL3263259
For the given ligand test1, we have found in our database that, being scored 0.31034482, the most similar ligand is CHEMBL3263259. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3263259 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | COC1COCCC1N[C@@H]2C[C@H]3OC(C[C@]3(C2)C(=O)N4CCc5ncc(cc5C4)C(F)(F)F)c6ccccc6 |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 1407004a 01829000 00104122 10010710 803c10b0 00204000 10004c00 2200104c 00302980 00080ad0 09308004 40839802 1400889a 03a90000 010a1480 020c900c 10a20220 0a000124 10e02000 00000201 c0020120 18208e30 37804080 89500018 00041403 c0002000 08084340 90000021 04400306 01060003 60120000 a2c02e00 |