On Target MC5R_HUMAN 0.265625/CHEMBL1221512
For the given ligand test1, we have found in our database that, being scored 0.265625, the most similar ligand is CHEMBL1221512. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1221512 (Similar Ligand) |
|---|---|
| CC6(C)O[C@H]1CC(=O)OC[C@]17[C@H]5CC[C@@]4(C)[C@H](c2ccoc2)OC(=O)[C@H]3O[C@]34[C@]5(C)C(=O)C[C@@H]67 | CC[C@H](C)[C@@H](CO[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(=O)(=O)C)C(=O)OC(C)C)NC[C@@H](N)CS |
|
|
|
|
|
|
| 00050040 81200008 80080102 00014300 802c00d1 00200000 00004000 00200040 000a6900 010a0040 04180000 4008d000 54008428 02b10000 00080000 5a089008 08820020 82050100 13402000 00002001 00000020 18000a00 05000040 08080014 00000400 80004000 00080410 0a800031 60000202 0002000a 40020000 02000400 | 00000040 05005200 00300100 80110740 000800c0 02002200 00000000 20000040 84000800 000848c0 08302000 4008f000 06018002 04040002 803c1008 180c1008 1c821000 82000000 04400008 00000201 40010120 38000e03 13000301 0244001c 38000c00 80000000 00800000 10000001 08000200 0006002b 20004000 03012620 |