On Target DRD1_HUMAN 0.19444445/CHEMBL416523
For the given ligand Biloblide D, we have found in our database that, being scored 0.19444445, the most similar ligand is CHEMBL416523. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL416523 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | COc1cccc2OCC(CNCCCCN3C(=O)CC4(CCCC4)CC3=O)Cc12 |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 04010001 01001218 20100108 00010700 00001000 02000000 42000000 20000200 00200800 000a08c0 08300000 50039040 0480801a 00000000 11000001 000c2008 00200000 22008004 00c02000 00020a01 00020100 18040610 010000c0 00500418 00000001 c0000000 00000000 10000000 00010300 0107800b 00020000 00002640 |