On Target 5HT7R_HUMAN 0.32330826/CHEMBL487192
For the given ligand Biloblide D, we have found in our database that, being scored 0.32330826, the most similar ligand is CHEMBL487192. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL487192 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | OC(=O)[C@@H](OC(=O)\C=C\c1ccc(O)c(O)c1)[C@](O)(Cc2ccc(O)c(O)c2)C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 00050000 43000008 20000502 00010300 002c0041 40200000 82000080 00000400 01800800 01080840 48100000 4010d080 1c008002 00200000 00040002 00089008 08020400 82000000 21418018 00020201 00000120 08000a00 05000041 08400014 00001c00 80000000 0052a000 40000420 00400202 0002010a 04000000 02400410 |