On Target 5HT4R_HUMAN 0.21794872/CHEMBL3741376
For the given ligand Biloblide D, we have found in our database that, being scored 0.21794872, the most similar ligand is CHEMBL3741376. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL3741376 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | CC(C)N1C(=O)N(C(=O)NCC2CCN(CC3(O)CCOCC3)CC2)c4ccccc14 |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 01000002 01201400 00100180 00010f00 801c00c0 00004000 00000000 e0002000 04200100 010008f0 0d20800c 50038000 00009002 00c00180 003800c0 000c100c 10830000 00008000 01e00080 00000201 c0000020 18050430 23800081 02300018 00000401 40040001 00000200 10080000 08000200 00460013 40080000 00002a80 |