On Target MC5R_HUMAN 0.19545455/CHEMBL2070254
For the given ligand Biloblide D, we have found in our database that, being scored 0.19545455, the most similar ligand is CHEMBL2070254. Check out the elaboration below.
| Biloblide D (Given Ligand) | CHEMBL2070254 (Similar Ligand) |
|---|---|
| [H][C@]24C[C@@](O)(C(C)(C)C)C13[C@@H](O)C(=O)O[C@]1([H])OC(=O)[C@]23CC(=O)O4 | CCCC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)COCCOCCNC(=O)CCCCCCCCCCCCCCCc1nnn[nH]1)C(=O)N[C@H]2CCC(=O)NCCCC[C@H](NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](Cc5ccccc5)NC(=O)[C@@H]6C[C@@H](O)CN6C2=O)C(=O)N |
|
|
|
|
|
|
| 00050040 01000000 00000100 00010b00 002c0040 00200000 00002800 08002000 00200000 01020020 00000000 4000d000 14008028 02800000 00080000 00289008 00820000 00000100 5140a000 00000001 00100020 10010a00 05000000 08000010 00000400 00000000 00008000 24000020 00000202 0100000a 00a20000 00000000 | 00070002 01007a18 40300100 c5810e10 101c1280 00000018 00002000 2008224c 00602a80 000b08c2 08308004 4003f040 1e0098ba 01402803 80181048 201d200c 10000000 86000800 00e02408 00000201 40160100 38358e38 37800083 9b50001c 00043c01 80000000 48800000 100000a1 0c000214 0006400b a00e4200 08802e20 |