On Target ACM5_HUMAN 0.3203125/CHEMBL1201027

For the given ligand Ginkgo B, we have found in our database that, being scored 0.3203125, the most similar ligand is CHEMBL1201027. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL1201027 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O [Br-].C[N+]1(C)CCC(C1)OC(=O)C(O)(C2CCCC2)c3ccccc3
2d depiction of Ginkgo B 2d depiction of CHEMBL1201027
3d depiction of Ginkgo B 3d depiction of CHEMBL1201027
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00010040 01000000 00100302 80010700 000800c0 00004010 00000000 00000040 00000900 000808c0 08300000 4000d000 0500800a 00a80000 40041008 00099008 18a60000 02000000 04c02000 00000001 00010120 18000a20 17000080 08400010 10000400 80000000 00000000 10000021 00000202 01060006 40022008 00000600