On Target CCR4_HUMAN 0.19711539/CHEMBL64391

For the given ligand Ginkgo B, we have found in our database that, being scored 0.19711539, the most similar ligand is CHEMBL64391. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL64391 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CCC(C)N1N=CN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(OCC5COC(Cn6cncn6)(O5)c7ccc(Cl)cc7Cl)cc4
2d depiction of Ginkgo B 2d depiction of CHEMBL64391
3d depiction of Ginkgo B 3d depiction of CHEMBL64391
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 0400c006 00801208 e0000128 84810700 00081050 0200c024 02002802 0000504c 04202100 81080ae0 0820000c 40008900 028088a6 00492400 112410c1 022b200c 08a49000 02080004 19400002 00261001 c01014b8 38048170 27000060 8f600012 10002400 80002220 400c0000 258000a0 0c008200 0006000a c0840000 02220700