On Target OPRM_HUMAN 0.3968254/CHEMBL3219937

For the given ligand Ginkgo B, we have found in our database that, being scored 0.3968254, the most similar ligand is CHEMBL3219937. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL3219937 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CCO[C@@H](C)O[C@H]1C[C@@H](C(=O)OC)[C@]2(C)CC[C@H]3C(=O)O[C@@H](C[C@]3(C)[C@H]2C1=O)c4cocc4
2d depiction of Ginkgo B 2d depiction of CHEMBL3219937
3d depiction of Ginkgo B 3d depiction of CHEMBL3219937
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00050040 81200000 00080102 00014300 80280011 00000000 00004800 08200000 002a4900 000a0060 04180000 4008d000 44008428 00b10000 00000000 52281008 08820020 82050100 1240a000 00002001 00000020 08000a00 01000000 00080014 00000400 00004000 00080410 2e800010 60000202 00020002 40220000 02000000