On Target MC4R_HUMAN 0.21818182/CHEMBL1519347
For the given ligand Ginkgo B, we have found in our database that, being scored 0.21818182, the most similar ligand is CHEMBL1519347. Check out the elaboration below.
| Ginkgo B (Given Ligand) | CHEMBL1519347 (Similar Ligand) |
|---|---|
| [H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O | O=C(Nc1ccccc1)OC2CCC3CC2CCC3OC(=O)Nc4ccccc4 |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00000002 01400000 00000100 00010300 00080000 00000000 00000000 80000000 00000204 00000840 00280004 40008000 00008000 02900100 00000040 00180008 00868000 00800000 0a402800 00400001 40000000 08000c10 21002002 00000010 00000000 00001002 00000000 00000080 00008200 80060003 00020000 00000000 |