On Target CCR1_HUMAN 0.22857143/CHEMBL344324

For the given ligand Ginkgo B, we have found in our database that, being scored 0.22857143, the most similar ligand is CHEMBL344324. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL344324 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CCOC(=O)C(CCCN1CCC(O)(CC1)c2ccc(Cl)cc2)(C#N)c3ccccc3
2d depiction of Ginkgo B 2d depiction of CHEMBL344324
3d depiction of Ginkgo B 3d depiction of CHEMBL344324
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00018000 01000200 00100102 00010700 00080040 00084000 00000000 20000040 00108900 000808c0 08300000 50019800 070088b6 01200000 40040000 000c100c 08c20000 02000000 04c00000 00000201 00010120 38000b20 01800480 00500010 00002401 80000000 00040000 10000000 00000200 0006000a 40002000 00022680