On Target TAAR1_HUMAN 0.24806201/CHEMBL1335190

For the given ligand Ginkgo B, we have found in our database that, being scored 0.24806201, the most similar ligand is CHEMBL1335190. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL1335190 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CC1OC(NCCc2ccccc2)C(O)C(O)C1O
2d depiction of Ginkgo B 2d depiction of CHEMBL1335190
3d depiction of Ginkgo B 3d depiction of CHEMBL1335190
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00000000 01400001 00100100 00010700 803800c0 00008000 00000000 a0000000 00400280 010808c0 08200000 40018000 00000002 01800100 00080000 001a9008 10000000 02080000 11c02800 00000201 00000020 18200010 07000080 89500010 00000401 80001002 00000000 10200060 04000200 00060002 80000000 00002e00