On Target OPRK_HUMAN 0.7777778/CHEMBL560302

For the given ligand Ginkgo B, we have found in our database that, being scored 0.7777778, the most similar ligand is CHEMBL560302. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL560302 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CO[C@H]1O[C@@H](OC)[C@](O)([C@@H]1O)[C@@H]2C[C@@]3(C)[C@@H](CC[C@@]4(C)[C@@H](C[C@H](OC(=O)C)C(=O)[C@H]34)C(=O)OC)C(=O)O2
2d depiction of Ginkgo B 2d depiction of CHEMBL560302
3d depiction of Ginkgo B 3d depiction of CHEMBL560302
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00050040 01000000 00000500 00010300 80280040 00000000 00002800 00000000 00200000 010200a0 00000000 4001d000 04008028 00800000 00080000 002a9008 00820000 80000100 1340a000 00000001 00100020 10000a00 05000000 08100014 00000400 00000000 00000000 24000020 00000200 0000000a 00a20000 02000000