On Target CXCR3_HUMAN 0.22289157/CHEMBL3956593

For the given ligand Ginkgo B, we have found in our database that, being scored 0.22289157, the most similar ligand is CHEMBL3956593. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL3956593 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CCOC(=O)C1CCC(CN(Cc2ccc(OCCN3C(=O)CCC3=O)c(OC)c2)C(C)c4ccc5OCCc5c4)CC1
2d depiction of Ginkgo B 2d depiction of CHEMBL3956593
3d depiction of Ginkgo B 3d depiction of CHEMBL3956593
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 04033000 45005008 20100108 00210702 000810c1 02000010 12040000 22001240 00000000 000808c0 08200000 40019000 0480c80a 00800000 010c1401 0208b018 18822000 02000000 06482400 00020201 00020020 18048e10 13000000 00548018 00000400 c0000000 08b20000 90800005 00000302 0006000b 20060000 00800680