On Target ADA2B_HUMAN 0.7307692/CHEMBL1909065

For the given ligand Ginkgo B, we have found in our database that, being scored 0.7307692, the most similar ligand is CHEMBL1909065. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL1909065 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CO[C@H]1C[C@@H](O[C@H]2C[C@@H](O[C@H]2[C@]3(C)CC[C@@H](O3)[C@]4(C)CC[C@]5(C[C@H](O)[C@@H](C)[C@H](O5)[C@@H](C)[C@@H]6O[C@](O)(CC(=O)O)[C@@H](C)[C@H](OC)[C@H]6OC)O4)[C@H]7O[C@](C)(O)[C@H](C)C[C@@H]7C)O[C@@H](C)[C@@H]1OC
2d depiction of Ginkgo B 2d depiction of CHEMBL1909065
3d depiction of Ginkgo B 3d depiction of CHEMBL1909065
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00010040 01000000 00000000 00810100 802c0040 00200000 00002800 08000040 00202000 01000020 00000000 40009000 14008028 02800000 00080000 002a9008 00800000 00000000 1140a000 00000001 00100020 10000a00 05000000 08000010 00000400 00000000 00000000 24000020 00000200 00000000 00a20000 00000000