On Target CNR1_HUMAN 0.4040404/CHEMBL175247

For the given ligand Ginkgo B, we have found in our database that, being scored 0.4040404, the most similar ligand is CHEMBL175247. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL175247 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CCCCCCCCCCC[C@@H](C[C@@H]1OC(=O)[C@H]1CCCCCC)OC(=O)[C@H](CC(C)C)NC=O
2d depiction of Ginkgo B 2d depiction of CHEMBL175247
3d depiction of Ginkgo B 3d depiction of CHEMBL175247
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00010040 01005000 00100100 80010700 000800c0 00000000 00000000 00000000 00000000 01000080 00200000 4000b000 14008028 02800000 00001008 00081008 10820000 00000000 01402000 00000001 00000020 10040e00 13000000 00000018 10000400 00000000 00800000 10000000 00000200 0004000b 20024000 00000200