On Target 5HT1F_HUMAN 0.15028901/CHEMBL321967

For the given ligand Ginkgo B, we have found in our database that, being scored 0.15028901, the most similar ligand is CHEMBL321967. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL321967 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CN1CCC(CC1)c2c[nH]c3ccc(NC(=O)C4CCCC4)nc23
2d depiction of Ginkgo B 2d depiction of CHEMBL321967
3d depiction of Ginkgo B 3d depiction of CHEMBL321967
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00014002 01800a00 00184180 40810610 200c1240 00002000 0000a000 20100000 00400800 200800c0 08380004 5001b000 0c00880a 00500800 00060840 00040004 08040000 02004008 08602400 00a00205 40100100 5c008618 21802840 80700010 00042000 80000000 08008080 10000084 00008008 0106180b 00041200 00000720