On Target NPBW1_HUMAN 0.20555556/CHEMBL1989216
For the given ligand Ginkgo B, we have found in our database that, being scored 0.20555556, the most similar ligand is CHEMBL1989216. Check out the elaboration below.
| Ginkgo B (Given Ligand) | CHEMBL1989216 (Similar Ligand) |
|---|---|
| [H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O | CCOC(=O)C(C(=O)OCC)C1=C(Cl)C=NN(Cc2cccc3ccccc23)C1=O |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00010014 42002608 30000180 00010618 000e0046 00208000 0004a000 00001060 06300100 810828c0 00002008 7001ba00 1700982a 08e00000 800c0000 000d200c 18020008 82004000 05200010 00220000 00010430 1c018b18 01800881 83700014 04107400 80000600 00128000 10040000 04000200 0006000a 00042000 00820020 |