On Target AA2AR_HUMAN 0.23863636/CHEMBL2113418

For the given ligand Ginkgo B, we have found in our database that, being scored 0.23863636, the most similar ligand is CHEMBL2113418. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL2113418 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)ncnc23)[C@](C)(O)[C@@H]1O
2d depiction of Ginkgo B 2d depiction of CHEMBL2113418
3d depiction of Ginkgo B 3d depiction of CHEMBL2113418
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 0005000a 01c01800 80180000 88090720 001800e0 0000c000 00008c00 a0000800 00400100 018000b0 0c20800c 4001d004 14009032 01880300 00081088 381fc00c 10200020 80000000 19c00000 80201201 80080020 10000670 378000c0 0c10001c 10000401 40080002 00000200 10000071 00000209 00460001 c0280000 00000ac0