On Target TSHR_HUMAN 0.17391305/CHEMBL3945037

For the given ligand Ginkgo B, we have found in our database that, being scored 0.17391305, the most similar ligand is CHEMBL3945037. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL3945037 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CC(=O)N1CCC(C)(c2ccccc2)c3cc(NC(=O)O[C@H]4CC5CC[C@H]4C5)ccc13
2d depiction of Ginkgo B 2d depiction of CHEMBL3945037
3d depiction of Ginkgo B 3d depiction of CHEMBL3945037
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 08004002 01401200 00100100 00010700 24084020 00082040 00000000 a1000000 00400a04 000808d0 08380024 40008000 00008002 00900900 00020040 001c0008 00868000 02800001 0a402808 00400201 44100100 18040e10 21002002 00400018 00040000 a1001002 00000010 50001080 00488280 8106000b 00020080 20000600