On Target CCR2_HUMAN 0.2983871/CHEMBL1684700

For the given ligand Ginkgo B, we have found in our database that, being scored 0.2983871, the most similar ligand is CHEMBL1684700. Check out the elaboration below.
Ginkgo B (Given Ligand) CHEMBL1684700 (Similar Ligand)
[H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H](O)[C@]5([H])OC(=O)[C@@H](C)[C@@]56O CO[C@@H]1COCC[C@@H]1N[C@@H]2CC[C@](C2)(C(C)C)C(=O)N3C[C@@H]4C[C@H]3CN4C(=O)C5CCCC5
2d depiction of Ginkgo B 2d depiction of CHEMBL1684700
3d depiction of Ginkgo B 3d depiction of CHEMBL1684700
00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 00030000 01003400 00100100 04010500 80280080 00000010 00000000 20000048 00202000 000001a0 00200000 40039000 0400801a 00082000 00081000 00088008 10200000 00000000 10c02000 00000201 00000020 300c0630 170000a1 0a100018 00000401 00000000 00000000 10000021 08000200 01040011 00020000 00802200