On Target 5HT1D_HUMAN 0.1764706/CHEMBL139801
For the given ligand Ginkgo A, we have found in our database that, being scored 0.1764706, the most similar ligand is CHEMBL139801. Check out the elaboration below.
| Ginkgo A (Given Ligand) | CHEMBL139801 (Similar Ligand) |
|---|---|
| [H][C@@H]2CC13[C@@H](O)C(=O)O[C@]1([H])OC46C(=O)O[C@@]2([H])C34[C@@H]([H])[C@]5([H])OC(=O)[C@@H](C)[C@@]56O | CN(C)CCn1ccc2ccc(cc12)C3(O)CCOCC3 |
|
|
|
|
|
|
| 00050040 01000000 00000500 00810b00 00280040 00000000 00002800 08002040 00202000 01020020 00000000 4000d000 14008028 02800000 00080000 08289008 00820000 80000100 1140a000 00000001 00100020 10010a00 05000000 08000014 00000400 00000000 00000000 24000020 00000200 0100000a 00a20000 00000000 | 00000002 01000808 00000100 40010700 800c4040 0000c000 00000000 00000000 00600900 010808c0 08300004 40018000 88000800 00400000 00000840 000c100c 00000000 02800000 01600000 00000001 40000120 38008078 21800040 80500010 08002400 80000000 00000040 00000000 08000200 00060012 40040200 00000620 |