On Target NK2R_HUMAN 0.280543/CHEMBL1083847
For the given ligand MM-24, we have found in our database that, being scored 0.280543, the most similar ligand is CHEMBL1083847. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL1083847 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | COc1ccc2oc(cc2c1)C(=O)NC3(CCCC3)C(=O)N[C@@H](CCCN4CCN(CC5CCOCC5)CC4)Cc6ccccc6 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 00018080 01203808 2018010a 04010700 84181200 00000000 02000000 6220120c 02204980 000b08c0 083000b0 4003b000 46008c1a 00202088 01000421 00081008 00004000 02000000 08402000 00020201 00000120 38268618 01000021 8358021c 08800420 e0000000 04100214 98000000 0c002382 01060203 a0044000 00002e00 |