On Target ADRB3_HUMAN 0.24736843/CHEMBL459862
For the given ligand MM-24, we have found in our database that, being scored 0.24736843, the most similar ligand is CHEMBL459862. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL459862 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | O[C@@H](CNCCOc1ccc(cc1)c2ccc(C(=O)O)c(OC3CCCCC3)c2)c4ccccc4 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 04002000 41000808 20100108 40050702 00081080 02024000 02040000 00000800 00000180 00080840 08200000 40008020 02808012 00800080 11281001 00082008 10820040 22008000 06482000 10021201 00000000 18260a20 13000000 81400014 00000000 80000000 00020800 00000041 04004300 00060002 c0005000 00000600 |