On Target TAAR1_HUMAN 0.25490198/CHEMBL1732597
For the given ligand MM-24, we have found in our database that, being scored 0.25490198, the most similar ligand is CHEMBL1732597. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL1732597 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | COc1cc(cc(OC)c1OC)C2C(C)C(NCCc3ccccc3)Oc4cc5OCOc5cc24 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 04000001 42000218 60100108 00010700 00001000 c2008000 42040000 21000200 04600a80 000808c0 48300000 40008040 00804002 20000000 11000001 003ea008 00000000 22088004 00480002 00020a01 00040300 18200010 01000040 83422410 40000000 e0010022 001a0000 70000000 05270380 0006800a 82000000 02012600 |