On Target 5HT5A_HUMAN 0.1889401/CHEMBL538029
For the given ligand MM-24, we have found in our database that, being scored 0.1889401, the most similar ligand is CHEMBL538029. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL538029 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | Cl.Clc1ccc(OC2CCN(CC[C@H]3CCCN3S(=O)(=O)c4ccc5cc[nH]c5c4)CC2)cc1 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 04008052 01800408 21100108 01b10600 000c1000 02000010 02010000 20000000 00000000 004009e0 00202004 70018800 02800807 00400001 81e00041 000c200c 00202010 00000400 00e02000 00027603 e0000000 18008118 21800080 98500018 02002001 0000000c 00100000 1000000c 00000600 20060010 00040200 00032270 |