On Target OPRK_HUMAN 0.3287037/CHEMBL4111049
For the given ligand MM-24, we have found in our database that, being scored 0.3287037, the most similar ligand is CHEMBL4111049. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL4111049 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | CCCC1O[C@@](C)([C@H]2C[C@]34CC[C@]2(O1)[C@@H]5Oc6c(O)ccc7C[C@H]3N(CC8CC8)CC[C@@]45c67)C(C)(C)C |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 04001040 43000208 2010050a 00a10700 00381061 c2000002 02803800 28000241 00202890 010818e0 08300000 50818040 00804002 21a00080 11240021 022cb018 08800200 22008000 1748a002 00020201 00100120 18200010 05004040 89500410 00000400 c0000001 00120200 34800020 04000302 0007c80a 00220000 00002f40 |