On Target AA1R_HUMAN 0.26404494/CHEMBL1990267
For the given ligand MM-24, we have found in our database that, being scored 0.26404494, the most similar ligand is CHEMBL1990267. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL1990267 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | COc1cccc2C=C(C(=O)N)C(=N)Oc12 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 08000000 00200808 30080108 00010620 00011245 00200100 02010000 40001200 00024000 00000840 00000020 40008400 40008c03 00000080 01042041 20000008 08000000 02010000 00080000 00020202 00000000 0a06860a 01000000 00480004 08402024 80004000 40000010 28900000 01082200 01060000 80040000 00010000 |