On Target CNR1_HUMAN 0.31707317/CHEMBL1923760
For the given ligand MM-24, we have found in our database that, being scored 0.31707317, the most similar ligand is CHEMBL1923760. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL1923760 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | CCCCCCc1ccc(O)cc1OCCCCCCCC(=O)OC(CO)CO |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 04010001 01000008 2000050a 00010300 00081000 82000000 42000000 00000200 00000800 00080840 08100000 40009040 0480800a 00a00000 11000001 0008b008 00820000 22008000 01402000 00020801 00000120 08000a00 05000000 08400410 00000400 c0000000 00120000 00000020 00010302 00024002 00020000 00000400 |