On Target CLTR1_HUMAN 0.32098764/CHEMBL1213920
For the given ligand MM-24, we have found in our database that, being scored 0.32098764, the most similar ligand is CHEMBL1213920. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL1213920 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | CCCOC1=C(Oc2c(cc(Br)cc2C1=O)C(=O)O)c3cccc(OCc4ccc5ccccc5n4)c3 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 0c406002 40208808 221a4108 10110200 0005122d 82004160 02050000 40802200 42024300 40000840 00080097 c0008400 40808c53 00750088 01020061 420c220c 0406c040 22808800 06280200 00021202 40240000 08128e2a b1804006 80d85114 08400000 80006004 14030074 08900048 00006304 11862201 c1441248 08240000 |